název výrobku |
4-Ethoxybenzonitrile |
Synonyma |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
Molekulární vzorec |
C9H9NO |
Molekulová hmotnost |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
Registrační číslo CAS |
25117-74-2 |
Molekulární struktura |
|
Hustota |
1.05g/cm3 |
Bod varu |
258°C at 760 mmHg |
Index lomu |
1.52 |
Bod vzplanutí |
110.9°C |
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|