उत्पाद का नाम |
4-Ethoxybenzonitrile |
समानार्थी |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
आणविक फार्मूला |
C9H9NO |
आण्विक वजन |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
कैस रजिस्टी संख्या |
25117-74-2 |
आणविक संरचना |
|
घनत्व |
1.05g/cm3 |
उबलने का समय |
258°C at 760 mmHg |
अपवर्तक सूचकांक |
1.52 |
फ्लैश प्वाइंट |
110.9°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|