Nome del prodotto |
4-Ethoxybenzonitrile |
Sinonimi |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
Formula molecolare |
C9H9NO |
Peso Molecolare |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
Numero CAS |
25117-74-2 |
Struttura molecolare |
|
Densità |
1.05g/cm3 |
Punto di ebollizione |
258°C at 760 mmHg |
Indice di rifrazione |
1.52 |
Punto d'infiammabilità |
110.9°C |
Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|