اسم المنتج |
4-Ethoxybenzonitrile |
الاسم المستعار |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
الصيغة الجزيئية |
C9H9NO |
الوزن الجزيئي الغرامي |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
إستراتيجية المساعدة القطرية |
25117-74-2 |
بنية جزيئية |
|
كثافة |
1.05g/cm3 |
نقطة الغليان |
258°C at 760 mmHg |
معامل الإنكسار |
1.52 |
نقطة الوميض |
110.9°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|