produktnavn |
4-Ethoxybenzonitrile |
Synonymer |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
Molekylær Formel |
C9H9NO |
Molekylvekt |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
CAS-nummer |
25117-74-2 |
Molecular Structure |
|
Tetthet |
1.05g/cm3 |
Kokepunkt |
258°C at 760 mmHg |
Brytningsindeks |
1.52 |
Flammepunktet |
110.9°C |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|