(3,5-Dimethyl-4-methoxyphenyl)boronic acid

שם המוצר	(3,5-Dimethyl-4-methoxyphenyl)boronic acid
נרדפות	4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid
מולקולרית פורמולה	C₉H₁₃BO₃
משקל מולקולרי	180.0087
InChI	InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3
מספר CAS	301699-39-8
מבנה מולקולרי
צפיפות	1.11g/cm³
נקודת ההתוך	235-242℃
נקודת רתיחה	335.8°C at 760 mmHg
משקל סגולי	1.517
נקודת הבזק	156.9°C
סיכונים קודי	R36/37/38:Irritating to eyes, respiratory system and skin.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;