상품명칭 |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
별명 |
4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
분자식 |
C9H13BO3 |
분자량 |
180.0087 |
InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
cas번호 |
301699-39-8 |
분자 구조 |
|
밀도 |
1.11g/cm3 |
녹는 점 |
235-242℃ |
비등점 |
335.8°C at 760 mmHg |
굴절 지수 |
1.517 |
인화점 |
156.9°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|