Nazwa produktu: |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
Synonimy |
4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
MF |
C9H13BO3 |
Masie cząsteczkowej |
180.0087 |
InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
Nr CAS |
301699-39-8 |
Struktury molekularnej |
|
Gęstość |
1.11g/cm3 |
Temperatura topnienia |
235-242℃ |
Temperatura wrzenia |
335.8°C at 760 mmHg |
Współczynnik załamania |
1.517 |
Temperatura zapłonu |
156.9°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|