(3,5-Dimethyl-4-methoxyphenyl)boronic acid

اسم المنتج	(3,5-Dimethyl-4-methoxyphenyl)boronic acid
الاسم المستعار	4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid
الصيغة الجزيئية	C₉H₁₃BO₃
الوزن الجزيئي الغرامي	180.0087
InChI	InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3
إستراتيجية المساعدة القطرية	301699-39-8
بنية جزيئية
كثافة	1.11g/cm³
درجة الإنصهار	235-242℃
نقطة الغليان	335.8°C at 760 mmHg
معامل الإنكسار	1.517
نقطة الوميض	156.9°C
خطر المصطلحات	R36/37/38:Irritating to eyes, respiratory system and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;