(3,5-Dimethyl-4-methoxyphenyl)boronic acid

उत्पाद का नाम	(3,5-Dimethyl-4-methoxyphenyl)boronic acid
समानार्थी	4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid
आणविक फार्मूला	C₉H₁₃BO₃
आण्विक वजन	180.0087
InChI	InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3
कैस रजिस्टी संख्या	301699-39-8
आणविक संरचना
घनत्व	1.11g/cm³
गलनांक	235-242℃
उबलने का समय	335.8°C at 760 mmHg
अपवर्तक सूचकांक	1.517
फ्लैश प्वाइंट	156.9°C
खतरे के कोड	R36/37/38:Irritating to eyes, respiratory system and skin.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;