نام محصول |
Succinic dihydrazide |
مترادف |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
میدان مغناطیسی |
C4H10N4O2 |
وزن مولکولی |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
شماره سیایاس |
4146-43-4 |
تعداد کمیسیون اروپایی |
223-970-9 |
ساختار مولکولی |
|
تراکم |
1.284g/cm3 |
نقطه ذوب |
170-168℃ |
نقطه غلیان |
540.2°C at 760 mmHg |
ضریب شکست |
1.525 |
نقطه اشتعال |
280.5°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|