Naam product |
Succinic dihydrazide |
Synoniemen |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
MF |
C4H10N4O2 |
Molecuulgewicht |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
CAS-nummer |
4146-43-4 |
EINECS |
223-970-9 |
Moleculaire Structuur |
|
Dichtheid |
1.284g/cm3 |
Smeltpunt |
170-168℃ |
Kookpunt |
540.2°C at 760 mmHg |
Brekingsindex |
1.525 |
Vlampunt |
280.5°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|