상품명칭 |
Succinic dihydrazide |
별명 |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
분자식 |
C4H10N4O2 |
분자량 |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
cas번호 |
4146-43-4 |
EC번호 |
223-970-9 |
분자 구조 |
|
밀도 |
1.284g/cm3 |
녹는 점 |
170-168℃ |
비등점 |
540.2°C at 760 mmHg |
굴절 지수 |
1.525 |
인화점 |
280.5°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|