Nama produk |
Succinic dihydrazide |
Sinonim |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
MF |
C4H10N4O2 |
Berat Molekul |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
CAS NO |
4146-43-4 |
EINECS |
223-970-9 |
Struktur Molekul |
|
Kepadatan |
1.284g/cm3 |
Titik lebur |
170-168℃ |
Titik didih |
540.2°C at 760 mmHg |
Indeks bias |
1.525 |
Titik nyala |
280.5°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|