اسم المنتج |
Succinic dihydrazide |
الاسم المستعار |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
الصيغة الجزيئية |
C4H10N4O2 |
الوزن الجزيئي الغرامي |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
إستراتيجية المساعدة القطرية |
4146-43-4 |
المفوضية الأوروبية رقم |
223-970-9 |
بنية جزيئية |
|
كثافة |
1.284g/cm3 |
درجة الإنصهار |
170-168℃ |
نقطة الغليان |
540.2°C at 760 mmHg |
معامل الإنكسار |
1.525 |
نقطة الوميض |
280.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|